C30H22N2 — CID 141243954
2-[2-(1H-indol-2-yl)-1,2-diphenylethenyl]-1H-indole (PubChem CID 141243954) has the molecular formula C30H22N2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[2-(1H-indol-2-yl)-1,2-diphenylethenyl]-1H-indole.
| Compound Name | 2-[2-(1H-indol-2-yl)-1,2-diphenylethenyl]-1H-indole |
|---|---|
| PubChem CID | 141243954 |
| Molecular Formula | C30H22N2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-[2-(1H-indol-2-yl)-1,2-diphenylethenyl]-1H-indole |
| SMILES | c1ccc(C(=C(c2ccccc2)c2cc3ccccc3[nH]2)c2cc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C30H22N2/c1-3-11-21(12-4-1)29(27-19-23-15-7-9-17-25(23)31-27)30(22-13-5-2-6-14-22)28-20-24-16-8-10-18-26(24)32-28/h1-20,31-32H |
| InChIKey | NPCKPBAMMFJCNZ-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|