C14H15N — CID 155367147
2-[(2E,4Z)-hexa-2,4-dien-3-yl]-1H-indole (PubChem CID 155367147) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-1H-indole.
| Compound Name | 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-1H-indole |
|---|---|
| PubChem CID | 155367147 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-1H-indole |
| SMILES | C/C=C\C(=C/C)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H15N/c1-3-7-11(4-2)14-10-12-8-5-6-9-13(12)15-14/h3-10,15H,1-2H3/b7-3-,11-4+ |
| InChIKey | WBLZIEKYOHEKFZ-VGQHJLIWSA-N |
| XLogP | 4.15 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|