About 1-piperidin-1-ylnonane-1,3-dione
1-piperidin-1-ylnonane-1,3-dione (PubChem CID 134893639) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-piperidin-1-ylnonane-1,3-dione.
Molecular Properties
| Compound Name | 1-piperidin-1-ylnonane-1,3-dione |
| PubChem CID | 134893639 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 1-piperidin-1-ylnonane-1,3-dione |
| SMILES | CCCCCCC(=O)CC(=O)N1CCCCC1 |
| InChI | InChI=1S/C14H25NO2/c1-2-3-4-6-9-13(16)12-14(17)15-10-7-5-8-11-15/h2-12H2,1H3 |
| InChIKey | KXPFOQPBPYCZEY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-piperidin-1-ylnonane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-1-ylnonane-1,3-dione?
The IUPAC name of 1-piperidin-1-ylnonane-1,3-dione (CID 134893639) is 1-piperidin-1-ylnonane-1,3-dione.
What is the SMILES notation for 1-piperidin-1-ylnonane-1,3-dione?
The canonical SMILES for 1-piperidin-1-ylnonane-1,3-dione is CCCCCCC(=O)CC(=O)N1CCCCC1.
What is the InChIKey of 1-piperidin-1-ylnonane-1,3-dione?
The InChIKey is KXPFOQPBPYCZEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO2/c1-2-3-4-6-9-13(16)12-14(17)15-10-7-5-8-11-15/h2-12H2,1H3.
What are the key properties of 1-piperidin-1-ylnonane-1,3-dione?
1-piperidin-1-ylnonane-1,3-dione has a molecular weight of 239.36 g/mol, XLogP of 2.93, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-1-ylnonane-1,3-dione is sourced from PubChem (CID 134893639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).