C20H31NO3 — CID 72869524
(3R,4R)-3-methyl-4-(oxan-4-yl)-1-(2-phenylmethoxyethyl)piperidin-4-ol (PubChem CID 72869524) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is (3R,4R)-3-methyl-4-(oxan-4-yl)-1-(2-phenylmethoxyethyl)piperidin-4-ol.
| Compound Name | (3R,4R)-3-methyl-4-(oxan-4-yl)-1-(2-phenylmethoxyethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 72869524 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | (3R,4R)-3-methyl-4-(oxan-4-yl)-1-(2-phenylmethoxyethyl)piperidin-4-ol |
| SMILES | C[C@@H]1CN(CCOCc2ccccc2)CC[C@@]1(O)C1CCOCC1 |
| InChI | InChI=1S/C20H31NO3/c1-17-15-21(11-14-24-16-18-5-3-2-4-6-18)10-9-20(17,22)19-7-12-23-13-8-19/h2-6,17,19,22H,7-16H2,1H3/t17-,20+/m1/s1 |
| InChIKey | XKQPHNXGPADPPR-XLIONFOSSA-N |
| XLogP | 2.70 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|