C16H25NO3 — CID 156603731
1-(furan-3-ylmethyl)-3-methyl-4-(oxan-4-yl)piperidin-4-ol (PubChem CID 156603731) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-(furan-3-ylmethyl)-3-methyl-4-(oxan-4-yl)piperidin-4-ol.
| Compound Name | 1-(furan-3-ylmethyl)-3-methyl-4-(oxan-4-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 156603731 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 1-(furan-3-ylmethyl)-3-methyl-4-(oxan-4-yl)piperidin-4-ol |
| SMILES | CC1CN(Cc2ccoc2)CCC1(O)C1CCOCC1 |
| InChI | InChI=1S/C16H25NO3/c1-13-10-17(11-14-2-7-20-12-14)6-5-16(13,18)15-3-8-19-9-4-15/h2,7,12-13,15,18H,3-6,8-11H2,1H3 |
| InChIKey | RPFLWNTWCNDBGX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |