C12H24N2O — CID 154672699
4,9-diethyl-1-oxa-4,9-diazaspiro[5.5]undecane (PubChem CID 154672699) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 4,9-diethyl-1-oxa-4,9-diazaspiro[5.5]undecane.
| Compound Name | 4,9-diethyl-1-oxa-4,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 154672699 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 4,9-diethyl-1-oxa-4,9-diazaspiro[5.5]undecane |
| SMILES | CCN1CCC2(CC1)CN(CC)CCO2 |
| InChI | InChI=1S/C12H24N2O/c1-3-13-7-5-12(6-8-13)11-14(4-2)9-10-15-12/h3-11H2,1-2H3 |
| InChIKey | WALYUDOHDJJVCR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |