About 4-ethylmorpholine;1-methyl-4-phenylbenzene
4-ethylmorpholine;1-methyl-4-phenylbenzene (PubChem CID 144997146) has the molecular formula C19H25NO
and a molecular weight of 283.42 g/mol. Its IUPAC name is 4-ethylmorpholine;1-methyl-4-phenylbenzene.
Molecular Properties
| Compound Name | 4-ethylmorpholine;1-methyl-4-phenylbenzene |
| PubChem CID | 144997146 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 4-ethylmorpholine;1-methyl-4-phenylbenzene |
| SMILES | CCN1CCOCC1.Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.C6H13NO/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-2-7-3-5-8-6-4-7/h2-10H,1H3;2-6H2,1H3 |
| InChIKey | VPARWCHYPNBORC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethylmorpholine;1-methyl-4-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylmorpholine;1-methyl-4-phenylbenzene?
The IUPAC name of 4-ethylmorpholine;1-methyl-4-phenylbenzene (CID 144997146) is 4-ethylmorpholine;1-methyl-4-phenylbenzene.
What is the SMILES notation for 4-ethylmorpholine;1-methyl-4-phenylbenzene?
The canonical SMILES for 4-ethylmorpholine;1-methyl-4-phenylbenzene is CCN1CCOCC1.Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 4-ethylmorpholine;1-methyl-4-phenylbenzene?
The InChIKey is VPARWCHYPNBORC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.C6H13NO/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-2-7-3-5-8-6-4-7/h2-10H,1H3;2-6H2,1H3.
What are the key properties of 4-ethylmorpholine;1-methyl-4-phenylbenzene?
4-ethylmorpholine;1-methyl-4-phenylbenzene has a molecular weight of 283.42 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylmorpholine;1-methyl-4-phenylbenzene is sourced from PubChem (CID 144997146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).