About 4-(1,1-dioxothiolan-3-yl)-N'-hydroxymorpholine-2-carboximidamide
4-(1,1-dioxothiolan-3-yl)-N'-hydroxymorpholine-2-carboximidamide (PubChem CID 79681148) has the molecular formula C9H17N3O4S
and a molecular weight of 263.32 g/mol. Its IUPAC name is 4-(1,1-dioxothiolan-3-yl)-N'-hydroxymorpholine-2-carboximidamide.
Molecular Properties
| Compound Name | 4-(1,1-dioxothiolan-3-yl)-N'-hydroxymorpholine-2-carboximidamide |
| PubChem CID | 79681148 |
| Molecular Formula | C9H17N3O4S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 4-(1,1-dioxothiolan-3-yl)-N'-hydroxymorpholine-2-carboximidamide |
| SMILES | NC(=NO)C1CN(C2CCS(=O)(=O)C2)CCO1 |
| InChI | InChI=1S/C9H17N3O4S/c10-9(11-13)8-5-12(2-3-16-8)7-1-4-17(14,15)6-7/h7-8,13H,1-6H2,(H2,10,11) |
| InChIKey | NMVDGYAXBRXCOO-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,1-dioxothiolan-3-yl)-N'-hydroxymorpholine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-dioxothiolan-3-yl)-N'-hydroxymorpholine-2-carboximidamide?
The IUPAC name of 4-(1,1-dioxothiolan-3-yl)-N'-hydroxymorpholine-2-carboximidamide (CID 79681148) is 4-(1,1-dioxothiolan-3-yl)-N'-hydroxymorpholine-2-carboximidamide.
What is the SMILES notation for 4-(1,1-dioxothiolan-3-yl)-N'-hydroxymorpholine-2-carboximidamide?
The canonical SMILES for 4-(1,1-dioxothiolan-3-yl)-N'-hydroxymorpholine-2-carboximidamide is NC(=NO)C1CN(C2CCS(=O)(=O)C2)CCO1.
What is the InChIKey of 4-(1,1-dioxothiolan-3-yl)-N'-hydroxymorpholine-2-carboximidamide?
The InChIKey is NMVDGYAXBRXCOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O4S/c10-9(11-13)8-5-12(2-3-16-8)7-1-4-17(14,15)6-7/h7-8,13H,1-6H2,(H2,10,11).
What are the key properties of 4-(1,1-dioxothiolan-3-yl)-N'-hydroxymorpholine-2-carboximidamide?
4-(1,1-dioxothiolan-3-yl)-N'-hydroxymorpholine-2-carboximidamide has a molecular weight of 263.32 g/mol, XLogP of -1.38, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dioxothiolan-3-yl)-N'-hydroxymorpholine-2-carboximidamide is sourced from PubChem (CID 79681148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).