C13H23N3O4 — CID 79905548
4-(2,6-dioxaspiro[4.5]decan-9-yl)-N'-hydroxymorpholine-2-carboximidamide (PubChem CID 79905548) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is 4-(2,6-dioxaspiro[4.5]decan-9-yl)-N'-hydroxymorpholine-2-carboximidamide.
| Compound Name | 4-(2,6-dioxaspiro[4.5]decan-9-yl)-N'-hydroxymorpholine-2-carboximidamide |
|---|---|
| PubChem CID | 79905548 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 4-(2,6-dioxaspiro[4.5]decan-9-yl)-N'-hydroxymorpholine-2-carboximidamide |
| SMILES | NC(=NO)C1CN(C2CCOC3(CCOC3)C2)CCO1 |
| InChI | InChI=1S/C13H23N3O4/c14-12(15-17)11-8-16(3-6-19-11)10-1-4-20-13(7-10)2-5-18-9-13/h10-11,17H,1-9H2,(H2,14,15) |
| InChIKey | HZEINGSOVIVYNG-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|