1-(1,1-dioxothiolan-3-yl)piperidine-3-carboxylic acid

C10H17NO4S — CID 16637312

IUPAC1-(1,1-dioxothiolan-3-yl)piperidine-3-carboxylic acid
SMILESO=C(O)C1CCCN(C2CCS(=O)(=O)C2)C1
InChIInChI=1S/C10H17NO4S/c12-10(13)8-2-1-4-11(6-8)9-3-5-16(14,15)7-9/h8-9H,1-7H2,(H,12,13)
InChIKeyDOJJWVPFWBVDKB-UHFFFAOYSA-N
MW247.32 g/mol
LogP-0.03
Rot. Bonds2

About 1-(1,1-dioxothiolan-3-yl)piperidine-3-carboxylic acid

1-(1,1-dioxothiolan-3-yl)piperidine-3-carboxylic acid (PubChem CID 16637312) has the molecular formula C10H17NO4S and a molecular weight of 247.32 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)piperidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(1,1-dioxothiolan-3-yl)piperidine-3-carboxylic acid
PubChem CID16637312
Molecular FormulaC10H17NO4S
Molecular Weight247.32 g/mol
Exact Mass247.09
IUPAC Name1-(1,1-dioxothiolan-3-yl)piperidine-3-carboxylic acid
SMILESO=C(O)C1CCCN(C2CCS(=O)(=O)C2)C1
InChIInChI=1S/C10H17NO4S/c12-10(13)8-2-1-4-11(6-8)9-3-5-16(14,15)7-9/h8-9H,1-7H2,(H,12,13)
InChIKeyDOJJWVPFWBVDKB-UHFFFAOYSA-N
XLogP-0.03
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.32
LogP ≤ 5-0.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-(1,1-dioxothiolan-3-yl)piperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,1-dioxothiolan-3-yl)piperidine-3-carboxylic acid?
The IUPAC name of 1-(1,1-dioxothiolan-3-yl)piperidine-3-carboxylic acid (CID 16637312) is 1-(1,1-dioxothiolan-3-yl)piperidine-3-carboxylic acid.
What is the SMILES notation for 1-(1,1-dioxothiolan-3-yl)piperidine-3-carboxylic acid?
The canonical SMILES for 1-(1,1-dioxothiolan-3-yl)piperidine-3-carboxylic acid is O=C(O)C1CCCN(C2CCS(=O)(=O)C2)C1.
What is the InChIKey of 1-(1,1-dioxothiolan-3-yl)piperidine-3-carboxylic acid?
The InChIKey is DOJJWVPFWBVDKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO4S/c12-10(13)8-2-1-4-11(6-8)9-3-5-16(14,15)7-9/h8-9H,1-7H2,(H,12,13).
What are the key properties of 1-(1,1-dioxothiolan-3-yl)piperidine-3-carboxylic acid?
1-(1,1-dioxothiolan-3-yl)piperidine-3-carboxylic acid has a molecular weight of 247.32 g/mol, XLogP of -0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothiolan-3-yl)piperidine-3-carboxylic acid is sourced from PubChem (CID 16637312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).