C10H19NO5S2 — CID 94347275
(3S)-1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol (PubChem CID 94347275) has the molecular formula C10H19NO5S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (3S)-1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol.
| Compound Name | (3S)-1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol |
|---|---|
| PubChem CID | 94347275 |
| Molecular Formula | C10H19NO5S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (3S)-1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-ol |
| SMILES | O=S1(=O)CCC(S(=O)(=O)N2CCC[C@H](O)C2)CC1 |
| InChI | InChI=1S/C10H19NO5S2/c12-9-2-1-5-11(8-9)18(15,16)10-3-6-17(13,14)7-4-10/h9-10,12H,1-8H2/t9-/m0/s1 |
| InChIKey | TUCXPUJVEFNWLT-VIFPVBQESA-N |
| XLogP | -0.65 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |