C11H21NO5S2 — CID 62085839
[1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-yl]methanol (PubChem CID 62085839) has the molecular formula C11H21NO5S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is [1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-yl]methanol.
| Compound Name | [1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 62085839 |
| Molecular Formula | C11H21NO5S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | [1-(1,1-dioxothian-4-yl)sulfonylpiperidin-3-yl]methanol |
| SMILES | O=S1(=O)CCC(S(=O)(=O)N2CCCC(CO)C2)CC1 |
| InChI | InChI=1S/C11H21NO5S2/c13-9-10-2-1-5-12(8-10)19(16,17)11-3-6-18(14,15)7-4-11/h10-11,13H,1-9H2 |
| InChIKey | ZQLCWYFGADCLNJ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |