C11H20ClNO4S2 — CID 63397522
4-[3-(chloromethyl)piperidin-1-yl]sulfonylthiane 1,1-dioxide (PubChem CID 63397522) has the molecular formula C11H20ClNO4S2 and a molecular weight of 329.87 g/mol. Its IUPAC name is 4-[3-(chloromethyl)piperidin-1-yl]sulfonylthiane 1,1-dioxide.
| Compound Name | 4-[3-(chloromethyl)piperidin-1-yl]sulfonylthiane 1,1-dioxide |
|---|---|
| PubChem CID | 63397522 |
| Molecular Formula | C11H20ClNO4S2 |
| Molecular Weight | 329.87 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 4-[3-(chloromethyl)piperidin-1-yl]sulfonylthiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)N2CCCC(CCl)C2)CC1 |
| InChI | InChI=1S/C11H20ClNO4S2/c12-8-10-2-1-5-13(9-10)19(16,17)11-3-6-18(14,15)7-4-11/h10-11H,1-9H2 |
| InChIKey | YGKYGJVKSVIPCT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.87 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|