C11H20BrNO4S2 — CID 114801782
4-[3-(2-bromoethyl)pyrrolidin-1-yl]sulfonylthiane 1,1-dioxide (PubChem CID 114801782) has the molecular formula C11H20BrNO4S2 and a molecular weight of 374.32 g/mol. Its IUPAC name is 4-[3-(2-bromoethyl)pyrrolidin-1-yl]sulfonylthiane 1,1-dioxide.
| Compound Name | 4-[3-(2-bromoethyl)pyrrolidin-1-yl]sulfonylthiane 1,1-dioxide |
|---|---|
| PubChem CID | 114801782 |
| Molecular Formula | C11H20BrNO4S2 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 4-[3-(2-bromoethyl)pyrrolidin-1-yl]sulfonylthiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)N2CCC(CCBr)C2)CC1 |
| InChI | InChI=1S/C11H20BrNO4S2/c12-5-1-10-2-6-13(9-10)19(16,17)11-3-7-18(14,15)8-4-11/h10-11H,1-9H2 |
| InChIKey | PJHVEKVWPVMRGK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|