C17H25N3O2 — CID 134160951
N-benzyl-4-(oxolan-3-yl)-1,4-diazepane-1-carboxamide (PubChem CID 134160951) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N-benzyl-4-(oxolan-3-yl)-1,4-diazepane-1-carboxamide.
| Compound Name | N-benzyl-4-(oxolan-3-yl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 134160951 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-benzyl-4-(oxolan-3-yl)-1,4-diazepane-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCCN(C2CCOC2)CC1 |
| InChI | InChI=1S/C17H25N3O2/c21-17(18-13-15-5-2-1-3-6-15)20-9-4-8-19(10-11-20)16-7-12-22-14-16/h1-3,5-6,16H,4,7-14H2,(H,18,21) |
| InChIKey | HLQVXVVCPHCHGX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |