C20H31N3O3 — CID 154914956
4-cyclopentyl-N-[(4-methylphenyl)methyl]-1,4-diazepane-1-carboxamide;formic acid (PubChem CID 154914956) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-cyclopentyl-N-[(4-methylphenyl)methyl]-1,4-diazepane-1-carboxamide;formic acid.
| Compound Name | 4-cyclopentyl-N-[(4-methylphenyl)methyl]-1,4-diazepane-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 154914956 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 4-cyclopentyl-N-[(4-methylphenyl)methyl]-1,4-diazepane-1-carboxamide;formic acid |
| SMILES | Cc1ccc(CNC(=O)N2CCCN(C3CCCC3)CC2)cc1.O=CO |
| InChI | InChI=1S/C19H29N3O.CH2O2/c1-16-7-9-17(10-8-16)15-20-19(23)22-12-4-11-21(13-14-22)18-5-2-3-6-18;2-1-3/h7-10,18H,2-6,11-15H2,1H3,(H,20,23);1H,(H,2,3) |
| InChIKey | CHLFHSUXVLLMJR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|