C16H17F2N3O4 — CID 155954918
methyl 3-[[(3aR,7aS)-2-oxo-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[2,3-c]pyridine-6-carbonyl]amino]-2,6-difluorobenzoate (PubChem CID 155954918) has the molecular formula C16H17F2N3O4 and a molecular weight of 353.33 g/mol. Its IUPAC name is methyl 3-[[(3aR,7aS)-2-oxo-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[2,3-c]pyridine-6-carbonyl]amino]-2,6-difluorobenzoate.
| Compound Name | methyl 3-[[(3aR,7aS)-2-oxo-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[2,3-c]pyridine-6-carbonyl]amino]-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 155954918 |
| Molecular Formula | C16H17F2N3O4 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | methyl 3-[[(3aR,7aS)-2-oxo-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[2,3-c]pyridine-6-carbonyl]amino]-2,6-difluorobenzoate |
| SMILES | COC(=O)c1c(F)ccc(NC(=O)N2CC[C@@H]3CC(=O)N[C@@H]3C2)c1F |
| InChI | InChI=1S/C16H17F2N3O4/c1-25-15(23)13-9(17)2-3-10(14(13)18)20-16(24)21-5-4-8-6-12(22)19-11(8)7-21/h2-3,8,11H,4-7H2,1H3,(H,19,22)(H,20,24)/t8-,11-/m1/s1 |
| InChIKey | IQNHMMFYOZEBIG-LDYMZIIASA-N |
| XLogP | 1.49 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |