C17H23FN2O — CID 51944857
(4aR,8aR)-N-(2-fluoro-5-methylphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxamide (PubChem CID 51944857) has the molecular formula C17H23FN2O and a molecular weight of 290.38 g/mol. Its IUPAC name is (4aR,8aR)-N-(2-fluoro-5-methylphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxamide.
| Compound Name | (4aR,8aR)-N-(2-fluoro-5-methylphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 51944857 |
| Molecular Formula | C17H23FN2O |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | (4aR,8aR)-N-(2-fluoro-5-methylphenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxamide |
| SMILES | Cc1ccc(F)c(NC(=O)N2CC[C@H]3CCCC[C@H]3C2)c1 |
| InChI | InChI=1S/C17H23FN2O/c1-12-6-7-15(18)16(10-12)19-17(21)20-9-8-13-4-2-3-5-14(13)11-20/h6-7,10,13-14H,2-5,8-9,11H2,1H3,(H,19,21)/t13-,14+/m1/s1 |
| InChIKey | YQUPEJYOTKBUOV-KGLIPLIRSA-N |
| XLogP | 4.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |