C13H18FN3O3S — CID 131961579
N-(2-fluoro-5-methylphenyl)-1-sulfamoylpiperidine-3-carboxamide (PubChem CID 131961579) has the molecular formula C13H18FN3O3S and a molecular weight of 315.37 g/mol. Its IUPAC name is N-(2-fluoro-5-methylphenyl)-1-sulfamoylpiperidine-3-carboxamide.
| Compound Name | N-(2-fluoro-5-methylphenyl)-1-sulfamoylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 131961579 |
| Molecular Formula | C13H18FN3O3S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | N-(2-fluoro-5-methylphenyl)-1-sulfamoylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(F)c(NC(=O)C2CCCN(S(N)(=O)=O)C2)c1 |
| InChI | InChI=1S/C13H18FN3O3S/c1-9-4-5-11(14)12(7-9)16-13(18)10-3-2-6-17(8-10)21(15,19)20/h4-5,7,10H,2-3,6,8H2,1H3,(H,16,18)(H2,15,19,20) |
| InChIKey | QVDHEXZMFXYBPI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |