C21H19F3N6O2 — CID 122347436
[4-[6-(pyridin-2-ylamino)pyridazin-3-yl]piperazin-1-yl]-(2,4,5-trifluoro-3-methoxyphenyl)methanone (PubChem CID 122347436) has the molecular formula C21H19F3N6O2 and a molecular weight of 444.42 g/mol. Its IUPAC name is [4-[6-(pyridin-2-ylamino)pyridazin-3-yl]piperazin-1-yl]-(2,4,5-trifluoro-3-methoxyphenyl)methanone.
| Compound Name | [4-[6-(pyridin-2-ylamino)pyridazin-3-yl]piperazin-1-yl]-(2,4,5-trifluoro-3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 122347436 |
| Molecular Formula | C21H19F3N6O2 |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [4-[6-(pyridin-2-ylamino)pyridazin-3-yl]piperazin-1-yl]-(2,4,5-trifluoro-3-methoxyphenyl)methanone |
| SMILES | COc1c(F)c(F)cc(C(=O)N2CCN(c3ccc(Nc4ccccn4)nn3)CC2)c1F |
| InChI | InChI=1S/C21H19F3N6O2/c1-32-20-18(23)13(12-14(22)19(20)24)21(31)30-10-8-29(9-11-30)17-6-5-16(27-28-17)26-15-4-2-3-7-25-15/h2-7,12H,8-11H2,1H3,(H,25,26,27) |
| InChIKey | HXFTXSLNDICWLN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|