C19H22F3N5O2 — CID 122351131
[4-[2-(ethylamino)-6-methylpyrimidin-4-yl]piperazin-1-yl]-(2,4,5-trifluoro-3-methoxyphenyl)methanone (PubChem CID 122351131) has the molecular formula C19H22F3N5O2 and a molecular weight of 409.41 g/mol. Its IUPAC name is [4-[2-(ethylamino)-6-methylpyrimidin-4-yl]piperazin-1-yl]-(2,4,5-trifluoro-3-methoxyphenyl)methanone.
| Compound Name | [4-[2-(ethylamino)-6-methylpyrimidin-4-yl]piperazin-1-yl]-(2,4,5-trifluoro-3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 122351131 |
| Molecular Formula | C19H22F3N5O2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | [4-[2-(ethylamino)-6-methylpyrimidin-4-yl]piperazin-1-yl]-(2,4,5-trifluoro-3-methoxyphenyl)methanone |
| SMILES | CCNc1nc(C)cc(N2CCN(C(=O)c3cc(F)c(F)c(OC)c3F)CC2)n1 |
| InChI | InChI=1S/C19H22F3N5O2/c1-4-23-19-24-11(2)9-14(25-19)26-5-7-27(8-6-26)18(28)12-10-13(20)16(22)17(29-3)15(12)21/h9-10H,4-8H2,1-3H3,(H,23,24,25) |
| InChIKey | HLBDGCATCREIFT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|