C24H23N5O8S — CID 19184667
N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide (PubChem CID 19184667) has the molecular formula C24H23N5O8S and a molecular weight of 541.54 g/mol. Its IUPAC name is N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide.
| Compound Name | N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide |
|---|---|
| PubChem CID | 19184667 |
| Molecular Formula | C24H23N5O8S |
| Molecular Weight | 541.54 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | N-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=O)CCCCCN3C(=O)c4cccc([N+](=O)[O-])c4C3=O)cc2)no1 |
| InChI | InChI=1S/C24H23N5O8S/c1-15-14-20(26-37-15)27-38(35,36)17-11-9-16(10-12-17)25-21(30)8-3-2-4-13-28-23(31)18-6-5-7-19(29(33)34)22(18)24(28)32/h5-7,9-12,14H,2-4,8,13H2,1H3,(H,25,30)(H,26,27) |
| InChIKey | NGVHAWVCWVJGRU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|