C26H27N5O5S — CID 2789368
N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide (PubChem CID 2789368) has the molecular formula C26H27N5O5S and a molecular weight of 521.60 g/mol. Its IUPAC name is N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide.
| Compound Name | N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 2789368 |
| Molecular Formula | C26H27N5O5S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=O)C(CC(C)C)N3C(=O)c4ccccc4C3=O)cc2)nc(C)n1 |
| InChI | InChI=1S/C26H27N5O5S/c1-15(2)13-22(31-25(33)20-7-5-6-8-21(20)26(31)34)24(32)29-18-9-11-19(12-10-18)37(35,36)30-23-14-16(3)27-17(4)28-23/h5-12,14-15,22H,13H2,1-4H3,(H,29,32)(H,27,28,30) |
| InChIKey | HCIYZCVSPKOWKO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|