C28H29N3O6S — CID 98396669
(2S)-2-(1,3-dioxoisoindol-2-yl)-N-[5-[(4-methoxyphenyl)sulfamoyl]-2-methylphenyl]-4-methylpentanamide (PubChem CID 98396669) has the molecular formula C28H29N3O6S and a molecular weight of 535.62 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[5-[(4-methoxyphenyl)sulfamoyl]-2-methylphenyl]-4-methylpentanamide.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[5-[(4-methoxyphenyl)sulfamoyl]-2-methylphenyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 98396669 |
| Molecular Formula | C28H29N3O6S |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[5-[(4-methoxyphenyl)sulfamoyl]-2-methylphenyl]-4-methylpentanamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C)c(NC(=O)[C@H](CC(C)C)N3C(=O)c4ccccc4C3=O)c2)cc1 |
| InChI | InChI=1S/C28H29N3O6S/c1-17(2)15-25(31-27(33)22-7-5-6-8-23(22)28(31)34)26(32)29-24-16-21(14-9-18(24)3)38(35,36)30-19-10-12-20(37-4)13-11-19/h5-14,16-17,25,30H,15H2,1-4H3,(H,29,32)/t25-/m0/s1 |
| InChIKey | HLKFUNXKXCWHID-VWLOTQADSA-N |
| XLogP | 4.45 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|