C21H19ClN2O5S — CID 155248981
2-[2-[(2-tert-butyl-6-chloro-1,3-benzoxazol-7-yl)sulfonyl]ethyl]isoindole-1,3-dione (PubChem CID 155248981) has the molecular formula C21H19ClN2O5S and a molecular weight of 446.91 g/mol. Its IUPAC name is 2-[2-[(2-tert-butyl-6-chloro-1,3-benzoxazol-7-yl)sulfonyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(2-tert-butyl-6-chloro-1,3-benzoxazol-7-yl)sulfonyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 155248981 |
| Molecular Formula | C21H19ClN2O5S |
| Molecular Weight | 446.91 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 2-[2-[(2-tert-butyl-6-chloro-1,3-benzoxazol-7-yl)sulfonyl]ethyl]isoindole-1,3-dione |
| SMILES | CC(C)(C)c1nc2ccc(Cl)c(S(=O)(=O)CCN3C(=O)c4ccccc4C3=O)c2o1 |
| InChI | InChI=1S/C21H19ClN2O5S/c1-21(2,3)20-23-15-9-8-14(22)17(16(15)29-20)30(27,28)11-10-24-18(25)12-6-4-5-7-13(12)19(24)26/h4-9H,10-11H2,1-3H3 |
| InChIKey | WWTZQGIMJJHTJK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 97.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.91 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|