C24H30N2O6Si2 — CID 102464800
6,13-bis(2-trimethylsilyloxyethyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 102464800) has the molecular formula C24H30N2O6Si2 and a molecular weight of 498.68 g/mol. Its IUPAC name is 6,13-bis(2-trimethylsilyloxyethyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-bis(2-trimethylsilyloxyethyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 102464800 |
| Molecular Formula | C24H30N2O6Si2 |
| Molecular Weight | 498.68 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 6,13-bis(2-trimethylsilyloxyethyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | C[Si](C)(C)OCCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(CCO[Si](C)(C)C)C3=O |
| InChI | InChI=1S/C24H30N2O6Si2/c1-33(2,3)31-13-11-25-21(27)15-7-9-17-20-18(10-8-16(19(15)20)22(25)28)24(30)26(23(17)29)12-14-32-34(4,5)6/h7-10H,11-14H2,1-6H3 |
| InChIKey | WRVGCLTXSZATSU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.68 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|