C18H16N2O5 — CID 159800155
ethanamine;13-ethyl-6-oxa-13-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 159800155) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is ethanamine;13-ethyl-6-oxa-13-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | ethanamine;13-ethyl-6-oxa-13-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 159800155 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | ethanamine;13-ethyl-6-oxa-13-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CCN.CCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)OC3=O |
| InChI | InChI=1S/C16H9NO5.C2H7N/c1-2-17-13(18)7-3-5-9-12-10(16(21)22-15(9)20)6-4-8(11(7)12)14(17)19;1-2-3/h3-6H,2H2,1H3;2-3H2,1H3 |
| InChIKey | NJRJKAQVCUYQQK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|