C37H24ClNO8 — CID 126183539
[2-[4-(4-methylbenzoyl)oxyphenyl]-2-oxoethyl] 3-[4-(4-chlorophenoxy)-1,3-dioxoisoindol-2-yl]benzoate (PubChem CID 126183539) has the molecular formula C37H24ClNO8 and a molecular weight of 646.05 g/mol. Its IUPAC name is [2-[4-(4-methylbenzoyl)oxyphenyl]-2-oxoethyl] 3-[4-(4-chlorophenoxy)-1,3-dioxoisoindol-2-yl]benzoate.
| Compound Name | [2-[4-(4-methylbenzoyl)oxyphenyl]-2-oxoethyl] 3-[4-(4-chlorophenoxy)-1,3-dioxoisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 126183539 |
| Molecular Formula | C37H24ClNO8 |
| Molecular Weight | 646.05 g/mol |
| Exact Mass | 645.12 |
| IUPAC Name | [2-[4-(4-methylbenzoyl)oxyphenyl]-2-oxoethyl] 3-[4-(4-chlorophenoxy)-1,3-dioxoisoindol-2-yl]benzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C(=O)COC(=O)c3cccc(N4C(=O)c5cccc(Oc6ccc(Cl)cc6)c5C4=O)c3)cc2)cc1 |
| InChI | InChI=1S/C37H24ClNO8/c1-22-8-10-24(11-9-22)37(44)47-29-16-12-23(13-17-29)31(40)21-45-36(43)25-4-2-5-27(20-25)39-34(41)30-6-3-7-32(33(30)35(39)42)46-28-18-14-26(38)15-19-28/h2-20H,21H2,1H3 |
| InChIKey | GDFPZTIKYHLGKD-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.05 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|