C15H11FN2O4 — CID 113201627
2-(4-fluoro-1,3-dioxoisoindol-2-yl)-N-(furan-2-ylmethyl)acetamide (PubChem CID 113201627) has the molecular formula C15H11FN2O4 and a molecular weight of 302.26 g/mol. Its IUPAC name is 2-(4-fluoro-1,3-dioxoisoindol-2-yl)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-(4-fluoro-1,3-dioxoisoindol-2-yl)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 113201627 |
| Molecular Formula | C15H11FN2O4 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-(4-fluoro-1,3-dioxoisoindol-2-yl)-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CN1C(=O)c2cccc(F)c2C1=O)NCc1ccco1 |
| InChI | InChI=1S/C15H11FN2O4/c16-11-5-1-4-10-13(11)15(21)18(14(10)20)8-12(19)17-7-9-3-2-6-22-9/h1-6H,7-8H2,(H,17,19) |
| InChIKey | XCEIGVCCRZAXAN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|