C13H8N4O5S — CID 2666576
2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 2666576) has the molecular formula C13H8N4O5S and a molecular weight of 332.30 g/mol. Its IUPAC name is 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 2666576 |
| Molecular Formula | C13H8N4O5S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Nc1nccs1 |
| InChI | InChI=1S/C13H8N4O5S/c18-9(15-13-14-4-5-23-13)6-16-11(19)7-2-1-3-8(17(21)22)10(7)12(16)20/h1-5H,6H2,(H,14,15,18) |
| InChIKey | SFZWNAMBISRMSJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|