C19H12N4O7S — CID 16559120
N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 16559120) has the molecular formula C19H12N4O7S and a molecular weight of 440.39 g/mol. Its IUPAC name is N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 16559120 |
| Molecular Formula | C19H12N4O7S |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | N-(6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-yl)-2-(4-nitro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Nc1nc2cc3c(cc2s1)OCCO3 |
| InChI | InChI=1S/C19H12N4O7S/c24-15(8-22-17(25)9-2-1-3-11(23(27)28)16(9)18(22)26)21-19-20-10-6-12-13(7-14(10)31-19)30-5-4-29-12/h1-3,6-7H,4-5,8H2,(H,20,21,24) |
| InChIKey | HCTXUDXPLDYSBB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 140.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|