C21H17N3O9 — CID 2587758
[(2R)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 2587758) has the molecular formula C21H17N3O9 and a molecular weight of 455.38 g/mol. Its IUPAC name is [(2R)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [(2R)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 2587758 |
| Molecular Formula | C21H17N3O9 |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | [(2R)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | C[C@@H](OC(=O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H17N3O9/c1-11(19(26)22-12-5-6-15-16(9-12)32-8-7-31-15)33-17(25)10-23-20(27)13-3-2-4-14(24(29)30)18(13)21(23)28/h2-6,9,11H,7-8,10H2,1H3,(H,22,26)/t11-/m1/s1 |
| InChIKey | VJIDPQUHKVRZNR-LLVKDONJSA-N |
| XLogP | 1.53 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|