C20H16N4O8 — CID 46666198
[1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 46666198) has the molecular formula C20H16N4O8 and a molecular weight of 440.37 g/mol. Its IUPAC name is [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 46666198 |
| Molecular Formula | C20H16N4O8 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | CC(OC(=O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)C(=O)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H16N4O8/c1-11(17(26)22-20(29)21-12-6-3-2-4-7-12)32-15(25)10-23-18(27)13-8-5-9-14(24(30)31)16(13)19(23)28/h2-9,11H,10H2,1H3,(H2,21,22,26,29) |
| InChIKey | MNYOTOYVVLMIOW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|