C20H15Cl2N3O6 — CID 55468328
[1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 55468328) has the molecular formula C20H15Cl2N3O6 and a molecular weight of 464.26 g/mol. Its IUPAC name is [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 55468328 |
| Molecular Formula | C20H15Cl2N3O6 |
| Molecular Weight | 464.26 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | CC(OC(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)C(=O)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H15Cl2N3O6/c1-10(17(27)24-20(30)23-11-5-3-2-4-6-11)31-16(26)9-25-18(28)12-7-14(21)15(22)8-13(12)19(25)29/h2-8,10H,9H2,1H3,(H2,23,24,27,30) |
| InChIKey | QPVNWHOTDHJNEE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|