C26H23N3O6 — CID 46666262
[1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate (PubChem CID 46666262) has the molecular formula C26H23N3O6 and a molecular weight of 473.49 g/mol. Its IUPAC name is [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate.
| Compound Name | [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
|---|---|
| PubChem CID | 46666262 |
| Molecular Formula | C26H23N3O6 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
| SMILES | CC(OC(=O)CCCN1C(=O)c2cccc3cccc(c23)C1=O)C(=O)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H23N3O6/c1-16(23(31)28-26(34)27-18-10-3-2-4-11-18)35-21(30)14-7-15-29-24(32)19-12-5-8-17-9-6-13-20(22(17)19)25(29)33/h2-6,8-13,16H,7,14-15H2,1H3,(H2,27,28,31,34) |
| InChIKey | DFSQTEIGPYMRBV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|