C24H19Cl2N3O5 — CID 25337981
[(2S)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate (PubChem CID 25337981) has the molecular formula C24H19Cl2N3O5 and a molecular weight of 500.34 g/mol. Its IUPAC name is [(2S)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate.
| Compound Name | [(2S)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
|---|---|
| PubChem CID | 25337981 |
| Molecular Formula | C24H19Cl2N3O5 |
| Molecular Weight | 500.34 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | [(2S)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
| SMILES | C[C@H](OC(=O)CCCN1C(=O)c2cccc3cccc(c23)C1=O)C(=O)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C24H19Cl2N3O5/c1-13(22(31)28-21-18(26)11-15(25)12-27-21)34-19(30)9-4-10-29-23(32)16-7-2-5-14-6-3-8-17(20(14)16)24(29)33/h2-3,5-8,11-13H,4,9-10H2,1H3,(H,27,28,31)/t13-/m0/s1 |
| InChIKey | QYNLZEGIMKYSQM-ZDUSSCGKSA-N |
| XLogP | 4.49 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|