C21H18Cl2N2O5 — CID 40855482
[(2R)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 40855482) has the molecular formula C21H18Cl2N2O5 and a molecular weight of 449.29 g/mol. Its IUPAC name is [(2R)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [(2R)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 40855482 |
| Molecular Formula | C21H18Cl2N2O5 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | [(2R)-1-[[(1R)-1-(2,4-dichlorophenyl)ethyl]amino]-1-oxopropan-2-yl] 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | C[C@@H](OC(=O)CN1C(=O)c2ccccc2C1=O)C(=O)N[C@H](C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H18Cl2N2O5/c1-11(14-8-7-13(22)9-17(14)23)24-19(27)12(2)30-18(26)10-25-20(28)15-5-3-4-6-16(15)21(25)29/h3-9,11-12H,10H2,1-2H3,(H,24,27)/t11-,12-/m1/s1 |
| InChIKey | STAJELFESCCLCF-VXGBXAGGSA-N |
| XLogP | 3.40 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|