C20H15N3O9 — CID 2380336
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 2380336) has the molecular formula C20H15N3O9 and a molecular weight of 441.35 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 2380336 |
| Molecular Formula | C20H15N3O9 |
| Molecular Weight | 441.35 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C(COC(=O)CCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H15N3O9/c24-16(21-11-4-5-14-15(8-11)32-10-31-14)9-30-17(25)6-7-22-19(26)12-2-1-3-13(23(28)29)18(12)20(22)27/h1-5,8H,6-7,9-10H2,(H,21,24) |
| InChIKey | DSDNUNLHSQAFKB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|