C17H15N3O8 — CID 3990242
[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 3990242) has the molecular formula C17H15N3O8 and a molecular weight of 389.32 g/mol. Its IUPAC name is [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 3990242 |
| Molecular Formula | C17H15N3O8 |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C(CCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)OCC(=O)N1CCCC1=O |
| InChI | InChI=1S/C17H15N3O8/c21-12-5-2-7-18(12)13(22)9-28-14(23)6-8-19-16(24)10-3-1-4-11(20(26)27)15(10)17(19)25/h1,3-4H,2,5-9H2 |
| InChIKey | WHOGLMBMBMNVPH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 144.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|