C19H16N4O9S — CID 2447855
[2-oxo-2-(4-sulfamoylanilino)ethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 2447855) has the molecular formula C19H16N4O9S and a molecular weight of 476.42 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 2447855 |
| Molecular Formula | C19H16N4O9S |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 3-(4-nitro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COC(=O)CCN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)cc1 |
| InChI | InChI=1S/C19H16N4O9S/c20-33(30,31)12-6-4-11(5-7-12)21-15(24)10-32-16(25)8-9-22-18(26)13-2-1-3-14(23(28)29)17(13)19(22)27/h1-7H,8-10H2,(H,21,24)(H2,20,30,31) |
| InChIKey | POJSGZWHXLBNMV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 196.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|