C19H23N3O4S2 — CID 8578622
[2-[(3R)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate (PubChem CID 8578622) has the molecular formula C19H23N3O4S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is [2-[(3R)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate.
| Compound Name | [2-[(3R)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate |
|---|---|
| PubChem CID | 8578622 |
| Molecular Formula | C19H23N3O4S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | [2-[(3R)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate |
| SMILES | NC(=O)[C@@H]1CCCN(C(=O)COC(=O)CCCSc2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C19H23N3O4S2/c20-18(25)13-5-3-9-22(11-13)16(23)12-26-17(24)8-4-10-27-19-21-14-6-1-2-7-15(14)28-19/h1-2,6-7,13H,3-5,8-12H2,(H2,20,25)/t13-/m1/s1 |
| InChIKey | BBVAOHJYEQYWIQ-CYBMUJFWSA-N |
| XLogP | 2.44 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|