C24H19N3O4S2 — CID 6872767
[3-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 6872767) has the molecular formula C24H19N3O4S2 and a molecular weight of 477.57 g/mol. Its IUPAC name is [3-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [3-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 6872767 |
| Molecular Formula | C24H19N3O4S2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | [3-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2cccc(/C=N/NC(=O)CSc3nc4ccccc4s3)c2)cc1 |
| InChI | InChI=1S/C24H19N3O4S2/c1-30-18-11-9-17(10-12-18)23(29)31-19-6-4-5-16(13-19)14-25-27-22(28)15-32-24-26-20-7-2-3-8-21(20)33-24/h2-14H,15H2,1H3,(H,27,28)/b25-14+ |
| InChIKey | AUQRWFFGGVUUAG-AFUMVMLFSA-N |
| XLogP | 4.77 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|