C23H17Cl2N3O2S2 — CID 46300952
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 46300952) has the molecular formula C23H17Cl2N3O2S2 and a molecular weight of 502.45 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 46300952 |
| Molecular Formula | C23H17Cl2N3O2S2 |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 501.01 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(E)-[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(CSc1nc2ccccc2s1)N/N=C/c1cccc(OCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C23H17Cl2N3O2S2/c24-18-9-8-16(11-19(18)25)13-30-17-5-3-4-15(10-17)12-26-28-22(29)14-31-23-27-20-6-1-2-7-21(20)32-23/h1-12H,13-14H2,(H,28,29)/b26-12+ |
| InChIKey | KFSFYAAIUHLZSS-RPPGKUMJSA-N |
| XLogP | 6.42 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|