C19H18ClN3O3S2 — CID 1001675
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylideneamino]acetamide (PubChem CID 1001675) has the molecular formula C19H18ClN3O3S2 and a molecular weight of 435.96 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 1001675 |
| Molecular Formula | C19H18ClN3O3S2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1c(Cl)cc(C=NNC(=O)CSc2nc3ccccc3s2)cc1OC |
| InChI | InChI=1S/C19H18ClN3O3S2/c1-3-26-18-13(20)8-12(9-15(18)25-2)10-21-23-17(24)11-27-19-22-14-6-4-5-7-16(14)28-19/h4-10H,3,11H2,1-2H3,(H,23,24) |
| InChIKey | PCTMWISHYFQECK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|