C23H16FN3O3S2 — CID 6872642
[3-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate (PubChem CID 6872642) has the molecular formula C23H16FN3O3S2 and a molecular weight of 465.53 g/mol. Its IUPAC name is [3-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate.
| Compound Name | [3-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 6872642 |
| Molecular Formula | C23H16FN3O3S2 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | [3-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate |
| SMILES | O=C(CSc1nc2ccccc2s1)N/N=C/c1cccc(OC(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C23H16FN3O3S2/c24-17-7-4-6-16(12-17)22(29)30-18-8-3-5-15(11-18)13-25-27-21(28)14-31-23-26-19-9-1-2-10-20(19)32-23/h1-13H,14H2,(H,27,28)/b25-13+ |
| InChIKey | ASEGMLHEBAQXDB-DHRITJCHSA-N |
| XLogP | 4.90 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|