C21H15N3O4S2 — CID 46300959
[4-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 46300959) has the molecular formula C21H15N3O4S2 and a molecular weight of 437.50 g/mol. Its IUPAC name is [4-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 46300959 |
| Molecular Formula | C21H15N3O4S2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | [4-[(E)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | O=C(CSc1nc2ccccc2s1)N/N=C/c1ccc(OC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C21H15N3O4S2/c25-19(13-29-21-23-16-4-1-2-6-18(16)30-21)24-22-12-14-7-9-15(10-8-14)28-20(26)17-5-3-11-27-17/h1-12H,13H2,(H,24,25)/b22-12+ |
| InChIKey | HRKMVNCHPDRWFH-WSDLNYQXSA-N |
| XLogP | 4.35 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|