C25H19FN4OS2 — CID 126239890
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]acetamide (PubChem CID 126239890) has the molecular formula C25H19FN4OS2 and a molecular weight of 474.59 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126239890 |
| Molecular Formula | C25H19FN4OS2 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]acetamide |
| SMILES | O=C(CSc1nc2ccccc2s1)N/N=C\c1ccc2c(ccn2Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C25H19FN4OS2/c26-20-5-3-4-18(13-20)15-30-11-10-19-12-17(8-9-22(19)30)14-27-29-24(31)16-32-25-28-21-6-1-2-7-23(21)33-25/h1-14H,15-16H2,(H,29,31)/b27-14- |
| InChIKey | WCZAIVHAVIPLOH-VYYCAZPPSA-N |
| XLogP | 5.68 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|