C30H24FN3O2 — CID 126234003
N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]-2-(4-phenylphenoxy)acetamide (PubChem CID 126234003) has the molecular formula C30H24FN3O2 and a molecular weight of 477.54 g/mol. Its IUPAC name is N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]-2-(4-phenylphenoxy)acetamide.
| Compound Name | N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]-2-(4-phenylphenoxy)acetamide |
|---|---|
| PubChem CID | 126234003 |
| Molecular Formula | C30H24FN3O2 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]-2-(4-phenylphenoxy)acetamide |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1)N/N=C\c1ccc2c(ccn2Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C30H24FN3O2/c31-27-8-4-5-23(18-27)20-34-16-15-26-17-22(9-14-29(26)34)19-32-33-30(35)21-36-28-12-10-25(11-13-28)24-6-2-1-3-7-24/h1-19H,20-21H2,(H,33,35)/b32-19- |
| InChIKey | RGNJGBGBSVKMTO-MZFJOGFUSA-N |
| XLogP | 6.02 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|