C25H18FN3O2 — CID 126241100
N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 126241100) has the molecular formula C25H18FN3O2 and a molecular weight of 411.44 g/mol. Its IUPAC name is N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126241100 |
| Molecular Formula | C25H18FN3O2 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-[(Z)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C\c1ccc2c(ccn2Cc2cccc(F)c2)c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C25H18FN3O2/c26-21-6-3-4-18(13-21)16-29-11-10-19-12-17(8-9-22(19)29)15-27-28-25(30)24-14-20-5-1-2-7-23(20)31-24/h1-15H,16H2,(H,28,30)/b27-15- |
| InChIKey | ALQRTAQYBKLPKB-DICXZTSXSA-N |
| XLogP | 5.34 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|