C22H16FN5O4 — CID 126232582
N-[(E)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]-2,4-dinitroaniline (PubChem CID 126232582) has the molecular formula C22H16FN5O4 and a molecular weight of 433.40 g/mol. Its IUPAC name is N-[(E)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 126232582 |
| Molecular Formula | C22H16FN5O4 |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[(E)-[1-[(3-fluorophenyl)methyl]indol-5-yl]methylideneamino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C/c2ccc3c(ccn3Cc3cccc(F)c3)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H16FN5O4/c23-18-3-1-2-16(11-18)14-26-9-8-17-10-15(4-7-21(17)26)13-24-25-20-6-5-19(27(29)30)12-22(20)28(31)32/h1-13,25H,14H2/b24-13+ |
| InChIKey | NKBBGVXQXDOKHI-ZMOGYAJESA-N |
| XLogP | 5.09 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|